C12H12ClF5N2 — CID 171312424
(1R)-2,2,3,3,3-pentafluoro-1-(2-methyl-1H-indol-3-yl)propan-1-amine;hydrochloride (PubChem CID 171312424) has the molecular formula C12H12ClF5N2 and a molecular weight of 314.69 g/mol. Its IUPAC name is (1R)-2,2,3,3,3-pentafluoro-1-(2-methyl-1H-indol-3-yl)propan-1-amine;hydrochloride.
| Compound Name | (1R)-2,2,3,3,3-pentafluoro-1-(2-methyl-1H-indol-3-yl)propan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 171312424 |
| Molecular Formula | C12H12ClF5N2 |
| Molecular Weight | 314.69 g/mol |
| Exact Mass | 314.06 |
| IUPAC Name | (1R)-2,2,3,3,3-pentafluoro-1-(2-methyl-1H-indol-3-yl)propan-1-amine;hydrochloride |
| SMILES | Cc1[nH]c2ccccc2c1[C@@H](N)C(F)(F)C(F)(F)F.Cl |
| InChI | InChI=1S/C12H11F5N2.ClH/c1-6-9(7-4-2-3-5-8(7)19-6)10(18)11(13,14)12(15,16)17;/h2-5,10,19H,18H2,1H3;1H/t10-;/m1./s1 |
| InChIKey | XBFOHYSTWXULLI-HNCPQSOCSA-N |
| XLogP | 4.10 |
| TPSA | 41.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.69 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|