C15H23N3 — CID 116934490
2,2-dimethyl-1-(2-methyl-1H-indol-3-yl)butane-1,4-diamine (PubChem CID 116934490) has the molecular formula C15H23N3 and a molecular weight of 245.37 g/mol. Its IUPAC name is 2,2-dimethyl-1-(2-methyl-1H-indol-3-yl)butane-1,4-diamine.
| Compound Name | 2,2-dimethyl-1-(2-methyl-1H-indol-3-yl)butane-1,4-diamine |
|---|---|
| PubChem CID | 116934490 |
| Molecular Formula | C15H23N3 |
| Molecular Weight | 245.37 g/mol |
| Exact Mass | 245.19 |
| IUPAC Name | 2,2-dimethyl-1-(2-methyl-1H-indol-3-yl)butane-1,4-diamine |
| SMILES | Cc1[nH]c2ccccc2c1C(N)C(C)(C)CCN |
| InChI | InChI=1S/C15H23N3/c1-10-13(14(17)15(2,3)8-9-16)11-6-4-5-7-12(11)18-10/h4-7,14,18H,8-9,16-17H2,1-3H3 |
| InChIKey | BBTYZQGPEFCANV-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 67.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.37 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|