C12H10Cl3NO2S2 — CID 1116511
N-[(1S)-2,2,2-trichloro-1-thiophen-2-ylethyl]benzenesulfonamide (PubChem CID 1116511) has the molecular formula C12H10Cl3NO2S2 and a molecular weight of 370.71 g/mol. Its IUPAC name is N-[(1S)-2,2,2-trichloro-1-thiophen-2-ylethyl]benzenesulfonamide.
| Compound Name | N-[(1S)-2,2,2-trichloro-1-thiophen-2-ylethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 1116511 |
| Molecular Formula | C12H10Cl3NO2S2 |
| Molecular Weight | 370.71 g/mol |
| Exact Mass | 368.92 |
| IUPAC Name | N-[(1S)-2,2,2-trichloro-1-thiophen-2-ylethyl]benzenesulfonamide |
| SMILES | O=S(=O)(N[C@@H](c1cccs1)C(Cl)(Cl)Cl)c1ccccc1 |
| InChI | InChI=1S/C12H10Cl3NO2S2/c13-12(14,15)11(10-7-4-8-19-10)16-20(17,18)9-5-2-1-3-6-9/h1-8,11,16H/t11-/m0/s1 |
| InChIKey | NNNLFBBUKQKHSN-NSHDSACASA-N |
| XLogP | 4.14 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.71 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|