C17H22N2O3S2 — CID 7110846
N-[(1R,2S)-1-morpholin-4-yl-1-thiophen-2-ylpropan-2-yl]benzenesulfonamide (PubChem CID 7110846) has the molecular formula C17H22N2O3S2 and a molecular weight of 366.51 g/mol. Its IUPAC name is N-[(1R,2S)-1-morpholin-4-yl-1-thiophen-2-ylpropan-2-yl]benzenesulfonamide.
| Compound Name | N-[(1R,2S)-1-morpholin-4-yl-1-thiophen-2-ylpropan-2-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 7110846 |
| Molecular Formula | C17H22N2O3S2 |
| Molecular Weight | 366.51 g/mol |
| Exact Mass | 366.11 |
| IUPAC Name | N-[(1R,2S)-1-morpholin-4-yl-1-thiophen-2-ylpropan-2-yl]benzenesulfonamide |
| SMILES | C[C@H](NS(=O)(=O)c1ccccc1)[C@H](c1cccs1)N1CCOCC1 |
| InChI | InChI=1S/C17H22N2O3S2/c1-14(18-24(20,21)15-6-3-2-4-7-15)17(16-8-5-13-23-16)19-9-11-22-12-10-19/h2-8,13-14,17-18H,9-12H2,1H3/t14-,17+/m0/s1 |
| InChIKey | KMYYBAQGVMPUSS-WMLDXEAASA-N |
| XLogP | 2.49 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.51 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |