C23H26N4O4S2 — CID 30889062
4-nitro-N-[(1R,2S)-1-(4-phenylpiperazin-1-yl)-1-thiophen-2-ylpropan-2-yl]benzenesulfonamide (PubChem CID 30889062) has the molecular formula C23H26N4O4S2 and a molecular weight of 486.62 g/mol. Its IUPAC name is 4-nitro-N-[(1R,2S)-1-(4-phenylpiperazin-1-yl)-1-thiophen-2-ylpropan-2-yl]benzenesulfonamide.
| Compound Name | 4-nitro-N-[(1R,2S)-1-(4-phenylpiperazin-1-yl)-1-thiophen-2-ylpropan-2-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 30889062 |
| Molecular Formula | C23H26N4O4S2 |
| Molecular Weight | 486.62 g/mol |
| Exact Mass | 486.14 |
| IUPAC Name | 4-nitro-N-[(1R,2S)-1-(4-phenylpiperazin-1-yl)-1-thiophen-2-ylpropan-2-yl]benzenesulfonamide |
| SMILES | C[C@H](NS(=O)(=O)c1ccc([N+](=O)[O-])cc1)[C@H](c1cccs1)N1CCN(c2ccccc2)CC1 |
| InChI | InChI=1S/C23H26N4O4S2/c1-18(24-33(30,31)21-11-9-20(10-12-21)27(28)29)23(22-8-5-17-32-22)26-15-13-25(14-16-26)19-6-3-2-4-7-19/h2-12,17-18,23-24H,13-16H2,1H3/t18-,23+/m0/s1 |
| InChIKey | WBCNNCQGMFGFOQ-FDDCHVKYSA-N |
| XLogP | 3.89 |
| TPSA | 95.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.62 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|