C23H25FN4O4S2 — CID 30889080
N-[(1R,2S)-1-[4-(2-fluorophenyl)piperazin-1-yl]-1-thiophen-2-ylpropan-2-yl]-4-nitrobenzenesulfonamide (PubChem CID 30889080) has the molecular formula C23H25FN4O4S2 and a molecular weight of 504.61 g/mol. Its IUPAC name is N-[(1R,2S)-1-[4-(2-fluorophenyl)piperazin-1-yl]-1-thiophen-2-ylpropan-2-yl]-4-nitrobenzenesulfonamide.
| Compound Name | N-[(1R,2S)-1-[4-(2-fluorophenyl)piperazin-1-yl]-1-thiophen-2-ylpropan-2-yl]-4-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 30889080 |
| Molecular Formula | C23H25FN4O4S2 |
| Molecular Weight | 504.61 g/mol |
| Exact Mass | 504.13 |
| IUPAC Name | N-[(1R,2S)-1-[4-(2-fluorophenyl)piperazin-1-yl]-1-thiophen-2-ylpropan-2-yl]-4-nitrobenzenesulfonamide |
| SMILES | C[C@H](NS(=O)(=O)c1ccc([N+](=O)[O-])cc1)[C@H](c1cccs1)N1CCN(c2ccccc2F)CC1 |
| InChI | InChI=1S/C23H25FN4O4S2/c1-17(25-34(31,32)19-10-8-18(9-11-19)28(29)30)23(22-7-4-16-33-22)27-14-12-26(13-15-27)21-6-3-2-5-20(21)24/h2-11,16-17,23,25H,12-15H2,1H3/t17-,23+/m0/s1 |
| InChIKey | NUCQDKDVZIWTNN-GAJHUEQPSA-N |
| XLogP | 4.03 |
| TPSA | 95.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.61 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|