C16H13Cl3N2O2S — CID 1117505
N-[(1S)-2,2,2-trichloro-1-(1H-indol-3-yl)ethyl]benzenesulfonamide (PubChem CID 1117505) has the molecular formula C16H13Cl3N2O2S and a molecular weight of 403.72 g/mol. Its IUPAC name is N-[(1S)-2,2,2-trichloro-1-(1H-indol-3-yl)ethyl]benzenesulfonamide.
| Compound Name | N-[(1S)-2,2,2-trichloro-1-(1H-indol-3-yl)ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 1117505 |
| Molecular Formula | C16H13Cl3N2O2S |
| Molecular Weight | 403.72 g/mol |
| Exact Mass | 401.98 |
| IUPAC Name | N-[(1S)-2,2,2-trichloro-1-(1H-indol-3-yl)ethyl]benzenesulfonamide |
| SMILES | O=S(=O)(N[C@@H](c1c[nH]c2ccccc12)C(Cl)(Cl)Cl)c1ccccc1 |
| InChI | InChI=1S/C16H13Cl3N2O2S/c17-16(18,19)15(13-10-20-14-9-5-4-8-12(13)14)21-24(22,23)11-6-2-1-3-7-11/h1-10,15,20-21H/t15-/m0/s1 |
| InChIKey | IAGKXBPVGZSOQX-HNNXBMFYSA-N |
| XLogP | 4.56 |
| TPSA | 61.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.72 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|