About 4-chloro-N-[2,2,2-trichloro-1-(5-fluoro-1H-indol-3-yl)ethyl]benzenesulfonamide
4-chloro-N-[2,2,2-trichloro-1-(5-fluoro-1H-indol-3-yl)ethyl]benzenesulfonamide (PubChem CID 139004840) has the molecular formula C16H11Cl4FN2O2S
and a molecular weight of 456.15 g/mol. Its IUPAC name is 4-chloro-N-[2,2,2-trichloro-1-(5-fluoro-1H-indol-3-yl)ethyl]benzenesulfonamide.
Molecular Properties
| Compound Name | 4-chloro-N-[2,2,2-trichloro-1-(5-fluoro-1H-indol-3-yl)ethyl]benzenesulfonamide |
| PubChem CID | 139004840 |
| Molecular Formula | C16H11Cl4FN2O2S |
| Molecular Weight | 456.15 g/mol |
| Exact Mass | 453.93 |
| IUPAC Name | 4-chloro-N-[2,2,2-trichloro-1-(5-fluoro-1H-indol-3-yl)ethyl]benzenesulfonamide |
| SMILES | O=S(=O)(NC(c1c[nH]c2ccc(F)cc12)C(Cl)(Cl)Cl)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C16H11Cl4FN2O2S/c17-9-1-4-11(5-2-9)26(24,25)23-15(16(18,19)20)13-8-22-14-6-3-10(21)7-12(13)14/h1-8,15,22-23H |
| InChIKey | VKTXNLQKHYWQAG-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 61.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 456.15 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 4-chloro-N-[2,2,2-trichloro-1-(5-fluoro-1H-indol-3-yl)ethyl]benzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-N-[2,2,2-trichloro-1-(5-fluoro-1H-indol-3-yl)ethyl]benzenesulfonamide?
The IUPAC name of 4-chloro-N-[2,2,2-trichloro-1-(5-fluoro-1H-indol-3-yl)ethyl]benzenesulfonamide (CID 139004840) is 4-chloro-N-[2,2,2-trichloro-1-(5-fluoro-1H-indol-3-yl)ethyl]benzenesulfonamide.
What is the SMILES notation for 4-chloro-N-[2,2,2-trichloro-1-(5-fluoro-1H-indol-3-yl)ethyl]benzenesulfonamide?
The canonical SMILES for 4-chloro-N-[2,2,2-trichloro-1-(5-fluoro-1H-indol-3-yl)ethyl]benzenesulfonamide is O=S(=O)(NC(c1c[nH]c2ccc(F)cc12)C(Cl)(Cl)Cl)c1ccc(Cl)cc1.
What is the InChIKey of 4-chloro-N-[2,2,2-trichloro-1-(5-fluoro-1H-indol-3-yl)ethyl]benzenesulfonamide?
The InChIKey is VKTXNLQKHYWQAG-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H11Cl4FN2O2S/c17-9-1-4-11(5-2-9)26(24,25)23-15(16(18,19)20)13-8-22-14-6-3-10(21)7-12(13)14/h1-8,15,22-23H.
What are the key properties of 4-chloro-N-[2,2,2-trichloro-1-(5-fluoro-1H-indol-3-yl)ethyl]benzenesulfonamide?
4-chloro-N-[2,2,2-trichloro-1-(5-fluoro-1H-indol-3-yl)ethyl]benzenesulfonamide has a molecular weight of 456.15 g/mol, XLogP of 5.35, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-N-[2,2,2-trichloro-1-(5-fluoro-1H-indol-3-yl)ethyl]benzenesulfonamide is sourced from PubChem (CID 139004840), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).