C16H11Cl4FN2O2S — CID 139004840
4-chloro-N-[2,2,2-trichloro-1-(5-fluoro-1H-indol-3-yl)ethyl]benzenesulfonamide (PubChem CID 139004840) has the molecular formula C16H11Cl4FN2O2S and a molecular weight of 456.15 g/mol. Its IUPAC name is 4-chloro-N-[2,2,2-trichloro-1-(5-fluoro-1H-indol-3-yl)ethyl]benzenesulfonamide.
| Compound Name | 4-chloro-N-[2,2,2-trichloro-1-(5-fluoro-1H-indol-3-yl)ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 139004840 |
| Molecular Formula | C16H11Cl4FN2O2S |
| Molecular Weight | 456.15 g/mol |
| Exact Mass | 453.93 |
| IUPAC Name | 4-chloro-N-[2,2,2-trichloro-1-(5-fluoro-1H-indol-3-yl)ethyl]benzenesulfonamide |
| SMILES | O=S(=O)(NC(c1c[nH]c2ccc(F)cc12)C(Cl)(Cl)Cl)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C16H11Cl4FN2O2S/c17-9-1-4-11(5-2-9)26(24,25)23-15(16(18,19)20)13-8-22-14-6-3-10(21)7-12(13)14/h1-8,15,22-23H |
| InChIKey | VKTXNLQKHYWQAG-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 61.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.15 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|