C17H14Cl4N2O2S — CID 1254421
4-chloro-N-[(1R)-2,2,2-trichloro-1-(1-methylindol-3-yl)ethyl]benzenesulfonamide (PubChem CID 1254421) has the molecular formula C17H14Cl4N2O2S and a molecular weight of 452.19 g/mol. Its IUPAC name is 4-chloro-N-[(1R)-2,2,2-trichloro-1-(1-methylindol-3-yl)ethyl]benzenesulfonamide.
| Compound Name | 4-chloro-N-[(1R)-2,2,2-trichloro-1-(1-methylindol-3-yl)ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 1254421 |
| Molecular Formula | C17H14Cl4N2O2S |
| Molecular Weight | 452.19 g/mol |
| Exact Mass | 449.95 |
| IUPAC Name | 4-chloro-N-[(1R)-2,2,2-trichloro-1-(1-methylindol-3-yl)ethyl]benzenesulfonamide |
| SMILES | Cn1cc([C@@H](NS(=O)(=O)c2ccc(Cl)cc2)C(Cl)(Cl)Cl)c2ccccc21 |
| InChI | InChI=1S/C17H14Cl4N2O2S/c1-23-10-14(13-4-2-3-5-15(13)23)16(17(19,20)21)22-26(24,25)12-8-6-11(18)7-9-12/h2-10,16,22H,1H3/t16-/m1/s1 |
| InChIKey | GTIMHWQAGLUSOG-MRXNPFEDSA-N |
| XLogP | 5.22 |
| TPSA | 51.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.19 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|