About 1,1-bis(4-chlorophenyl)-2-(1-methylindol-3-yl)ethane-1,2-diol
1,1-bis(4-chlorophenyl)-2-(1-methylindol-3-yl)ethane-1,2-diol (PubChem CID 102266914) has the molecular formula C23H19Cl2NO2
and a molecular weight of 412.32 g/mol. Its IUPAC name is 1,1-bis(4-chlorophenyl)-2-(1-methylindol-3-yl)ethane-1,2-diol.
Molecular Properties
| Compound Name | 1,1-bis(4-chlorophenyl)-2-(1-methylindol-3-yl)ethane-1,2-diol |
| PubChem CID | 102266914 |
| Molecular Formula | C23H19Cl2NO2 |
| Molecular Weight | 412.32 g/mol |
| Exact Mass | 411.08 |
| IUPAC Name | 1,1-bis(4-chlorophenyl)-2-(1-methylindol-3-yl)ethane-1,2-diol |
| SMILES | Cn1cc(C(O)C(O)(c2ccc(Cl)cc2)c2ccc(Cl)cc2)c2ccccc21 |
| InChI | InChI=1S/C23H19Cl2NO2/c1-26-14-20(19-4-2-3-5-21(19)26)22(27)23(28,15-6-10-17(24)11-7-15)16-8-12-18(25)13-9-16/h2-14,22,27-28H,1H3 |
| InChIKey | YXBQDJQGDUMCKE-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 45.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 412.32 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1,1-bis(4-chlorophenyl)-2-(1-methylindol-3-yl)ethane-1,2-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1-bis(4-chlorophenyl)-2-(1-methylindol-3-yl)ethane-1,2-diol?
The IUPAC name of 1,1-bis(4-chlorophenyl)-2-(1-methylindol-3-yl)ethane-1,2-diol (CID 102266914) is 1,1-bis(4-chlorophenyl)-2-(1-methylindol-3-yl)ethane-1,2-diol.
What is the SMILES notation for 1,1-bis(4-chlorophenyl)-2-(1-methylindol-3-yl)ethane-1,2-diol?
The canonical SMILES for 1,1-bis(4-chlorophenyl)-2-(1-methylindol-3-yl)ethane-1,2-diol is Cn1cc(C(O)C(O)(c2ccc(Cl)cc2)c2ccc(Cl)cc2)c2ccccc21.
What is the InChIKey of 1,1-bis(4-chlorophenyl)-2-(1-methylindol-3-yl)ethane-1,2-diol?
The InChIKey is YXBQDJQGDUMCKE-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H19Cl2NO2/c1-26-14-20(19-4-2-3-5-21(19)26)22(27)23(28,15-6-10-17(24)11-7-15)16-8-12-18(25)13-9-16/h2-14,22,27-28H,1H3.
What are the key properties of 1,1-bis(4-chlorophenyl)-2-(1-methylindol-3-yl)ethane-1,2-diol?
1,1-bis(4-chlorophenyl)-2-(1-methylindol-3-yl)ethane-1,2-diol has a molecular weight of 412.32 g/mol, XLogP of 5.45, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1-bis(4-chlorophenyl)-2-(1-methylindol-3-yl)ethane-1,2-diol is sourced from PubChem (CID 102266914), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).