C17H14ClN3O2 — CID 9206903
N'-(4-chlorobenzoyl)-1-methylindole-3-carbohydrazide (PubChem CID 9206903) has the molecular formula C17H14ClN3O2 and a molecular weight of 327.77 g/mol. Its IUPAC name is N'-(4-chlorobenzoyl)-1-methylindole-3-carbohydrazide.
| Compound Name | N'-(4-chlorobenzoyl)-1-methylindole-3-carbohydrazide |
|---|---|
| PubChem CID | 9206903 |
| Molecular Formula | C17H14ClN3O2 |
| Molecular Weight | 327.77 g/mol |
| Exact Mass | 327.08 |
| IUPAC Name | N'-(4-chlorobenzoyl)-1-methylindole-3-carbohydrazide |
| SMILES | Cn1cc(C(=O)NNC(=O)c2ccc(Cl)cc2)c2ccccc21 |
| InChI | InChI=1S/C17H14ClN3O2/c1-21-10-14(13-4-2-3-5-15(13)21)17(23)20-19-16(22)11-6-8-12(18)9-7-11/h2-10H,1H3,(H,19,22)(H,20,23) |
| InChIKey | URKDYKXGERXOCO-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 63.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.77 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|