C18H17N3O4S — CID 7594196
N'-(4-acetylphenyl)sulfonyl-1-methylindole-3-carbohydrazide (PubChem CID 7594196) has the molecular formula C18H17N3O4S and a molecular weight of 371.42 g/mol. Its IUPAC name is N'-(4-acetylphenyl)sulfonyl-1-methylindole-3-carbohydrazide.
| Compound Name | N'-(4-acetylphenyl)sulfonyl-1-methylindole-3-carbohydrazide |
|---|---|
| PubChem CID | 7594196 |
| Molecular Formula | C18H17N3O4S |
| Molecular Weight | 371.42 g/mol |
| Exact Mass | 371.09 |
| IUPAC Name | N'-(4-acetylphenyl)sulfonyl-1-methylindole-3-carbohydrazide |
| SMILES | CC(=O)c1ccc(S(=O)(=O)NNC(=O)c2cn(C)c3ccccc23)cc1 |
| InChI | InChI=1S/C18H17N3O4S/c1-12(22)13-7-9-14(10-8-13)26(24,25)20-19-18(23)16-11-21(2)17-6-4-3-5-15(16)17/h3-11,20H,1-2H3,(H,19,23) |
| InChIKey | WXCKPLOVWAWEPX-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 97.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.42 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|