C20H20N4O4S — CID 8823945
1-methyl-N'-[4-(2-oxopyrrolidin-1-yl)phenyl]sulfonylindole-3-carbohydrazide (PubChem CID 8823945) has the molecular formula C20H20N4O4S and a molecular weight of 412.47 g/mol. Its IUPAC name is 1-methyl-N'-[4-(2-oxopyrrolidin-1-yl)phenyl]sulfonylindole-3-carbohydrazide.
| Compound Name | 1-methyl-N'-[4-(2-oxopyrrolidin-1-yl)phenyl]sulfonylindole-3-carbohydrazide |
|---|---|
| PubChem CID | 8823945 |
| Molecular Formula | C20H20N4O4S |
| Molecular Weight | 412.47 g/mol |
| Exact Mass | 412.12 |
| IUPAC Name | 1-methyl-N'-[4-(2-oxopyrrolidin-1-yl)phenyl]sulfonylindole-3-carbohydrazide |
| SMILES | Cn1cc(C(=O)NNS(=O)(=O)c2ccc(N3CCCC3=O)cc2)c2ccccc21 |
| InChI | InChI=1S/C20H20N4O4S/c1-23-13-17(16-5-2-3-6-18(16)23)20(26)21-22-29(27,28)15-10-8-14(9-11-15)24-12-4-7-19(24)25/h2-3,5-6,8-11,13,22H,4,7,12H2,1H3,(H,21,26) |
| InChIKey | HWSASONPSDEIIE-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 100.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.47 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|