C21H21N3O2 — CID 40717487
N'-[2-(2,3-dihydro-1H-inden-5-yl)acetyl]-1-methylindole-3-carbohydrazide (PubChem CID 40717487) has the molecular formula C21H21N3O2 and a molecular weight of 347.42 g/mol. Its IUPAC name is N'-[2-(2,3-dihydro-1H-inden-5-yl)acetyl]-1-methylindole-3-carbohydrazide.
| Compound Name | N'-[2-(2,3-dihydro-1H-inden-5-yl)acetyl]-1-methylindole-3-carbohydrazide |
|---|---|
| PubChem CID | 40717487 |
| Molecular Formula | C21H21N3O2 |
| Molecular Weight | 347.42 g/mol |
| Exact Mass | 347.16 |
| IUPAC Name | N'-[2-(2,3-dihydro-1H-inden-5-yl)acetyl]-1-methylindole-3-carbohydrazide |
| SMILES | Cn1cc(C(=O)NNC(=O)Cc2ccc3c(c2)CCC3)c2ccccc21 |
| InChI | InChI=1S/C21H21N3O2/c1-24-13-18(17-7-2-3-8-19(17)24)21(26)23-22-20(25)12-14-9-10-15-5-4-6-16(15)11-14/h2-3,7-11,13H,4-6,12H2,1H3,(H,22,25)(H,23,26) |
| InChIKey | LOUNBHDEROEUMA-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 63.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.42 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|