C21H19N5O3 — CID 40717499
1-methyl-N'-[2-(3-methyl-4-oxophthalazin-1-yl)acetyl]indole-3-carbohydrazide (PubChem CID 40717499) has the molecular formula C21H19N5O3 and a molecular weight of 389.42 g/mol. Its IUPAC name is 1-methyl-N'-[2-(3-methyl-4-oxophthalazin-1-yl)acetyl]indole-3-carbohydrazide.
| Compound Name | 1-methyl-N'-[2-(3-methyl-4-oxophthalazin-1-yl)acetyl]indole-3-carbohydrazide |
|---|---|
| PubChem CID | 40717499 |
| Molecular Formula | C21H19N5O3 |
| Molecular Weight | 389.42 g/mol |
| Exact Mass | 389.15 |
| IUPAC Name | 1-methyl-N'-[2-(3-methyl-4-oxophthalazin-1-yl)acetyl]indole-3-carbohydrazide |
| SMILES | Cn1nc(CC(=O)NNC(=O)c2cn(C)c3ccccc23)c2ccccc2c1=O |
| InChI | InChI=1S/C21H19N5O3/c1-25-12-16(14-8-5-6-10-18(14)25)20(28)23-22-19(27)11-17-13-7-3-4-9-15(13)21(29)26(2)24-17/h3-10,12H,11H2,1-2H3,(H,22,27)(H,23,28) |
| InChIKey | VTDKZXLCGOZAGL-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 98.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.42 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|