C23H23N5O3 — CID 55408908
N'-(1-methylindole-3-carbonyl)-3-(2-methylpropyl)-4-oxophthalazine-1-carbohydrazide (PubChem CID 55408908) has the molecular formula C23H23N5O3 and a molecular weight of 417.47 g/mol. Its IUPAC name is N'-(1-methylindole-3-carbonyl)-3-(2-methylpropyl)-4-oxophthalazine-1-carbohydrazide.
| Compound Name | N'-(1-methylindole-3-carbonyl)-3-(2-methylpropyl)-4-oxophthalazine-1-carbohydrazide |
|---|---|
| PubChem CID | 55408908 |
| Molecular Formula | C23H23N5O3 |
| Molecular Weight | 417.47 g/mol |
| Exact Mass | 417.18 |
| IUPAC Name | N'-(1-methylindole-3-carbonyl)-3-(2-methylpropyl)-4-oxophthalazine-1-carbohydrazide |
| SMILES | CC(C)Cn1nc(C(=O)NNC(=O)c2cn(C)c3ccccc23)c2ccccc2c1=O |
| InChI | InChI=1S/C23H23N5O3/c1-14(2)12-28-23(31)17-10-5-4-9-16(17)20(26-28)22(30)25-24-21(29)18-13-27(3)19-11-7-6-8-15(18)19/h4-11,13-14H,12H2,1-3H3,(H,24,29)(H,25,30) |
| InChIKey | YVBSIJVKZYACSF-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 98.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.47 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|