C20H17N5O4 — CID 40716285
N'-[2-(1,4-dioxo-3H-phthalazin-2-yl)acetyl]-1-methylindole-3-carbohydrazide (PubChem CID 40716285) has the molecular formula C20H17N5O4 and a molecular weight of 391.39 g/mol. Its IUPAC name is N'-[2-(1,4-dioxo-3H-phthalazin-2-yl)acetyl]-1-methylindole-3-carbohydrazide.
| Compound Name | N'-[2-(1,4-dioxo-3H-phthalazin-2-yl)acetyl]-1-methylindole-3-carbohydrazide |
|---|---|
| PubChem CID | 40716285 |
| Molecular Formula | C20H17N5O4 |
| Molecular Weight | 391.39 g/mol |
| Exact Mass | 391.13 |
| IUPAC Name | N'-[2-(1,4-dioxo-3H-phthalazin-2-yl)acetyl]-1-methylindole-3-carbohydrazide |
| SMILES | Cn1cc(C(=O)NNC(=O)Cn2[nH]c(=O)c3ccccc3c2=O)c2ccccc21 |
| InChI | InChI=1S/C20H17N5O4/c1-24-10-15(12-6-4-5-9-16(12)24)18(27)22-21-17(26)11-25-20(29)14-8-3-2-7-13(14)19(28)23-25/h2-10H,11H2,1H3,(H,21,26)(H,22,27)(H,23,28) |
| InChIKey | ZGWOGYIQQMSVAY-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 117.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.39 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|