C15H12BrN5O4 — CID 9256039
4-bromo-N'-[2-(1,4-dioxo-3H-phthalazin-2-yl)acetyl]-1H-pyrrole-2-carbohydrazide (PubChem CID 9256039) has the molecular formula C15H12BrN5O4 and a molecular weight of 406.20 g/mol. Its IUPAC name is 4-bromo-N'-[2-(1,4-dioxo-3H-phthalazin-2-yl)acetyl]-1H-pyrrole-2-carbohydrazide.
| Compound Name | 4-bromo-N'-[2-(1,4-dioxo-3H-phthalazin-2-yl)acetyl]-1H-pyrrole-2-carbohydrazide |
|---|---|
| PubChem CID | 9256039 |
| Molecular Formula | C15H12BrN5O4 |
| Molecular Weight | 406.20 g/mol |
| Exact Mass | 405.01 |
| IUPAC Name | 4-bromo-N'-[2-(1,4-dioxo-3H-phthalazin-2-yl)acetyl]-1H-pyrrole-2-carbohydrazide |
| SMILES | O=C(Cn1[nH]c(=O)c2ccccc2c1=O)NNC(=O)c1cc(Br)c[nH]1 |
| InChI | InChI=1S/C15H12BrN5O4/c16-8-5-11(17-6-8)14(24)19-18-12(22)7-21-15(25)10-4-2-1-3-9(10)13(23)20-21/h1-6,17H,7H2,(H,18,22)(H,19,24)(H,20,23) |
| InChIKey | KCTQKJXNTLWHFP-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 128.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.20 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|