C16H17N3O5S — CID 8823087
2-methyl-N'-[4-(2-oxopyrrolidin-1-yl)phenyl]sulfonylfuran-3-carbohydrazide (PubChem CID 8823087) has the molecular formula C16H17N3O5S and a molecular weight of 363.40 g/mol. Its IUPAC name is 2-methyl-N'-[4-(2-oxopyrrolidin-1-yl)phenyl]sulfonylfuran-3-carbohydrazide.
| Compound Name | 2-methyl-N'-[4-(2-oxopyrrolidin-1-yl)phenyl]sulfonylfuran-3-carbohydrazide |
|---|---|
| PubChem CID | 8823087 |
| Molecular Formula | C16H17N3O5S |
| Molecular Weight | 363.40 g/mol |
| Exact Mass | 363.09 |
| IUPAC Name | 2-methyl-N'-[4-(2-oxopyrrolidin-1-yl)phenyl]sulfonylfuran-3-carbohydrazide |
| SMILES | Cc1occc1C(=O)NNS(=O)(=O)c1ccc(N2CCCC2=O)cc1 |
| InChI | InChI=1S/C16H17N3O5S/c1-11-14(8-10-24-11)16(21)17-18-25(22,23)13-6-4-12(5-7-13)19-9-2-3-15(19)20/h4-8,10,18H,2-3,9H2,1H3,(H,17,21) |
| InChIKey | BOIUHRBACWGXDV-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 108.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.40 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|