C16H13ClN4O5S — CID 25359424
N'-(4-chloro-3-nitrophenyl)sulfonyl-1-methylindole-3-carbohydrazide (PubChem CID 25359424) has the molecular formula C16H13ClN4O5S and a molecular weight of 408.82 g/mol. Its IUPAC name is N'-(4-chloro-3-nitrophenyl)sulfonyl-1-methylindole-3-carbohydrazide.
| Compound Name | N'-(4-chloro-3-nitrophenyl)sulfonyl-1-methylindole-3-carbohydrazide |
|---|---|
| PubChem CID | 25359424 |
| Molecular Formula | C16H13ClN4O5S |
| Molecular Weight | 408.82 g/mol |
| Exact Mass | 408.03 |
| IUPAC Name | N'-(4-chloro-3-nitrophenyl)sulfonyl-1-methylindole-3-carbohydrazide |
| SMILES | Cn1cc(C(=O)NNS(=O)(=O)c2ccc(Cl)c([N+](=O)[O-])c2)c2ccccc21 |
| InChI | InChI=1S/C16H13ClN4O5S/c1-20-9-12(11-4-2-3-5-14(11)20)16(22)18-19-27(25,26)10-6-7-13(17)15(8-10)21(23)24/h2-9,19H,1H3,(H,18,22) |
| InChIKey | UUHQIPVYQBMIRI-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 123.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.82 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|