C19H20N4O4S — CID 55556337
N-[2-methyl-5-[[(1-methylindole-3-carbonyl)amino]carbamoyl]phenyl]methanesulfonamide (PubChem CID 55556337) has the molecular formula C19H20N4O4S and a molecular weight of 400.46 g/mol. Its IUPAC name is N-[2-methyl-5-[[(1-methylindole-3-carbonyl)amino]carbamoyl]phenyl]methanesulfonamide.
| Compound Name | N-[2-methyl-5-[[(1-methylindole-3-carbonyl)amino]carbamoyl]phenyl]methanesulfonamide |
|---|---|
| PubChem CID | 55556337 |
| Molecular Formula | C19H20N4O4S |
| Molecular Weight | 400.46 g/mol |
| Exact Mass | 400.12 |
| IUPAC Name | N-[2-methyl-5-[[(1-methylindole-3-carbonyl)amino]carbamoyl]phenyl]methanesulfonamide |
| SMILES | Cc1ccc(C(=O)NNC(=O)c2cn(C)c3ccccc23)cc1NS(C)(=O)=O |
| InChI | InChI=1S/C19H20N4O4S/c1-12-8-9-13(10-16(12)22-28(3,26)27)18(24)20-21-19(25)15-11-23(2)17-7-5-4-6-14(15)17/h4-11,22H,1-3H3,(H,20,24)(H,21,25) |
| InChIKey | HPNYLBRSLUCMTG-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 109.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.46 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|