C21H24N4O4S — CID 55408588
2,4-dimethyl-N-[3-[2-(1-methylindole-3-carbonyl)hydrazinyl]-3-oxopropyl]benzenesulfonamide (PubChem CID 55408588) has the molecular formula C21H24N4O4S and a molecular weight of 428.51 g/mol. Its IUPAC name is 2,4-dimethyl-N-[3-[2-(1-methylindole-3-carbonyl)hydrazinyl]-3-oxopropyl]benzenesulfonamide.
| Compound Name | 2,4-dimethyl-N-[3-[2-(1-methylindole-3-carbonyl)hydrazinyl]-3-oxopropyl]benzenesulfonamide |
|---|---|
| PubChem CID | 55408588 |
| Molecular Formula | C21H24N4O4S |
| Molecular Weight | 428.51 g/mol |
| Exact Mass | 428.15 |
| IUPAC Name | 2,4-dimethyl-N-[3-[2-(1-methylindole-3-carbonyl)hydrazinyl]-3-oxopropyl]benzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)NCCC(=O)NNC(=O)c2cn(C)c3ccccc23)c(C)c1 |
| InChI | InChI=1S/C21H24N4O4S/c1-14-8-9-19(15(2)12-14)30(28,29)22-11-10-20(26)23-24-21(27)17-13-25(3)18-7-5-4-6-16(17)18/h4-9,12-13,22H,10-11H2,1-3H3,(H,23,26)(H,24,27) |
| InChIKey | LLNCJJLGYKXZKJ-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 109.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.51 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|