C21H25N3O3S — CID 51164021
3-[(2,4-dimethylphenyl)sulfonylamino]-N-[2-(1H-indol-3-yl)ethyl]propanamide (PubChem CID 51164021) has the molecular formula C21H25N3O3S and a molecular weight of 399.52 g/mol. Its IUPAC name is 3-[(2,4-dimethylphenyl)sulfonylamino]-N-[2-(1H-indol-3-yl)ethyl]propanamide.
| Compound Name | 3-[(2,4-dimethylphenyl)sulfonylamino]-N-[2-(1H-indol-3-yl)ethyl]propanamide |
|---|---|
| PubChem CID | 51164021 |
| Molecular Formula | C21H25N3O3S |
| Molecular Weight | 399.52 g/mol |
| Exact Mass | 399.16 |
| IUPAC Name | 3-[(2,4-dimethylphenyl)sulfonylamino]-N-[2-(1H-indol-3-yl)ethyl]propanamide |
| SMILES | Cc1ccc(S(=O)(=O)NCCC(=O)NCCc2c[nH]c3ccccc23)c(C)c1 |
| InChI | InChI=1S/C21H25N3O3S/c1-15-7-8-20(16(2)13-15)28(26,27)24-12-10-21(25)22-11-9-17-14-23-19-6-4-3-5-18(17)19/h3-8,13-14,23-24H,9-12H2,1-2H3,(H,22,25) |
| InChIKey | PWUKQUZHWCTICI-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 91.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.52 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |