C19H20N4OS — CID 8001040
1-(3,5-dimethylphenyl)-3-[(1-methylindole-3-carbonyl)amino]thiourea (PubChem CID 8001040) has the molecular formula C19H20N4OS and a molecular weight of 352.46 g/mol. Its IUPAC name is 1-(3,5-dimethylphenyl)-3-[(1-methylindole-3-carbonyl)amino]thiourea.
| Compound Name | 1-(3,5-dimethylphenyl)-3-[(1-methylindole-3-carbonyl)amino]thiourea |
|---|---|
| PubChem CID | 8001040 |
| Molecular Formula | C19H20N4OS |
| Molecular Weight | 352.46 g/mol |
| Exact Mass | 352.14 |
| IUPAC Name | 1-(3,5-dimethylphenyl)-3-[(1-methylindole-3-carbonyl)amino]thiourea |
| SMILES | Cc1cc(C)cc(NC(=S)NNC(=O)c2cn(C)c3ccccc23)c1 |
| InChI | InChI=1S/C19H20N4OS/c1-12-8-13(2)10-14(9-12)20-19(25)22-21-18(24)16-11-23(3)17-7-5-4-6-15(16)17/h4-11H,1-3H3,(H,21,24)(H2,20,22,25) |
| InChIKey | KJYNFONWJKRYEP-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 58.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.46 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thio_urea_C(9)', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|