C16H22N4OS — CID 9187866
1-[(1-methylindole-3-carbonyl)amino]-3-pentylthiourea (PubChem CID 9187866) has the molecular formula C16H22N4OS and a molecular weight of 318.45 g/mol. Its IUPAC name is 1-[(1-methylindole-3-carbonyl)amino]-3-pentylthiourea.
| Compound Name | 1-[(1-methylindole-3-carbonyl)amino]-3-pentylthiourea |
|---|---|
| PubChem CID | 9187866 |
| Molecular Formula | C16H22N4OS |
| Molecular Weight | 318.45 g/mol |
| Exact Mass | 318.15 |
| IUPAC Name | 1-[(1-methylindole-3-carbonyl)amino]-3-pentylthiourea |
| SMILES | CCCCCNC(=S)NNC(=O)c1cn(C)c2ccccc12 |
| InChI | InChI=1S/C16H22N4OS/c1-3-4-7-10-17-16(22)19-18-15(21)13-11-20(2)14-9-6-5-8-12(13)14/h5-6,8-9,11H,3-4,7,10H2,1-2H3,(H,18,21)(H2,17,19,22) |
| InChIKey | IJJBPEJONUYKCE-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 58.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.45 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|