C16H21N3O2 — CID 9227848
1-methyl-N-[(2S)-1-oxo-1-(propylamino)propan-2-yl]indole-3-carboxamide (PubChem CID 9227848) has the molecular formula C16H21N3O2 and a molecular weight of 287.36 g/mol. Its IUPAC name is 1-methyl-N-[(2S)-1-oxo-1-(propylamino)propan-2-yl]indole-3-carboxamide.
| Compound Name | 1-methyl-N-[(2S)-1-oxo-1-(propylamino)propan-2-yl]indole-3-carboxamide |
|---|---|
| PubChem CID | 9227848 |
| Molecular Formula | C16H21N3O2 |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.16 |
| IUPAC Name | 1-methyl-N-[(2S)-1-oxo-1-(propylamino)propan-2-yl]indole-3-carboxamide |
| SMILES | CCCNC(=O)[C@H](C)NC(=O)c1cn(C)c2ccccc12 |
| InChI | InChI=1S/C16H21N3O2/c1-4-9-17-15(20)11(2)18-16(21)13-10-19(3)14-8-6-5-7-12(13)14/h5-8,10-11H,4,9H2,1-3H3,(H,17,20)(H,18,21)/t11-/m0/s1 |
| InChIKey | HDTWUTZVHZHJKQ-NSHDSACASA-N |
| XLogP | 1.82 |
| TPSA | 63.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |