C17H12Cl2FN3O2 — CID 26815716
N'-(2,4-dichloro-5-fluorobenzoyl)-1-methylindole-3-carbohydrazide (PubChem CID 26815716) has the molecular formula C17H12Cl2FN3O2 and a molecular weight of 380.21 g/mol. Its IUPAC name is N'-(2,4-dichloro-5-fluorobenzoyl)-1-methylindole-3-carbohydrazide.
| Compound Name | N'-(2,4-dichloro-5-fluorobenzoyl)-1-methylindole-3-carbohydrazide |
|---|---|
| PubChem CID | 26815716 |
| Molecular Formula | C17H12Cl2FN3O2 |
| Molecular Weight | 380.21 g/mol |
| Exact Mass | 379.03 |
| IUPAC Name | N'-(2,4-dichloro-5-fluorobenzoyl)-1-methylindole-3-carbohydrazide |
| SMILES | Cn1cc(C(=O)NNC(=O)c2cc(F)c(Cl)cc2Cl)c2ccccc21 |
| InChI | InChI=1S/C17H12Cl2FN3O2/c1-23-8-11(9-4-2-3-5-15(9)23)17(25)22-21-16(24)10-6-14(20)13(19)7-12(10)18/h2-8H,1H3,(H,21,24)(H,22,25) |
| InChIKey | ZVYBFOCYPXXSJA-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 63.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.21 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|