C17H13Cl2N3O2 — CID 55666003
3-chloro-N'-(4-chlorobenzoyl)-1-methylindole-2-carbohydrazide (PubChem CID 55666003) has the molecular formula C17H13Cl2N3O2 and a molecular weight of 362.22 g/mol. Its IUPAC name is 3-chloro-N'-(4-chlorobenzoyl)-1-methylindole-2-carbohydrazide.
| Compound Name | 3-chloro-N'-(4-chlorobenzoyl)-1-methylindole-2-carbohydrazide |
|---|---|
| PubChem CID | 55666003 |
| Molecular Formula | C17H13Cl2N3O2 |
| Molecular Weight | 362.22 g/mol |
| Exact Mass | 361.04 |
| IUPAC Name | 3-chloro-N'-(4-chlorobenzoyl)-1-methylindole-2-carbohydrazide |
| SMILES | Cn1c(C(=O)NNC(=O)c2ccc(Cl)cc2)c(Cl)c2ccccc21 |
| InChI | InChI=1S/C17H13Cl2N3O2/c1-22-13-5-3-2-4-12(13)14(19)15(22)17(24)21-20-16(23)10-6-8-11(18)9-7-10/h2-9H,1H3,(H,20,23)(H,21,24) |
| InChIKey | WLWVCSLTEXLSNE-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 63.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.22 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|