C17H17ClN2O3S — CID 90535166
3-chloro-N-[2-hydroxy-2-(1-methylindol-3-yl)ethyl]benzenesulfonamide (PubChem CID 90535166) has the molecular formula C17H17ClN2O3S and a molecular weight of 364.85 g/mol. Its IUPAC name is 3-chloro-N-[2-hydroxy-2-(1-methylindol-3-yl)ethyl]benzenesulfonamide.
| Compound Name | 3-chloro-N-[2-hydroxy-2-(1-methylindol-3-yl)ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 90535166 |
| Molecular Formula | C17H17ClN2O3S |
| Molecular Weight | 364.85 g/mol |
| Exact Mass | 364.06 |
| IUPAC Name | 3-chloro-N-[2-hydroxy-2-(1-methylindol-3-yl)ethyl]benzenesulfonamide |
| SMILES | Cn1cc(C(O)CNS(=O)(=O)c2cccc(Cl)c2)c2ccccc21 |
| InChI | InChI=1S/C17H17ClN2O3S/c1-20-11-15(14-7-2-3-8-16(14)20)17(21)10-19-24(22,23)13-6-4-5-12(18)9-13/h2-9,11,17,19,21H,10H2,1H3 |
| InChIKey | UJFPNDVJDBGDAM-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 71.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.85 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |