C17H16F2N2O3S — CID 90535169
3,5-difluoro-N-[2-hydroxy-2-(1-methylindol-3-yl)ethyl]benzenesulfonamide (PubChem CID 90535169) has the molecular formula C17H16F2N2O3S and a molecular weight of 366.39 g/mol. Its IUPAC name is 3,5-difluoro-N-[2-hydroxy-2-(1-methylindol-3-yl)ethyl]benzenesulfonamide.
| Compound Name | 3,5-difluoro-N-[2-hydroxy-2-(1-methylindol-3-yl)ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 90535169 |
| Molecular Formula | C17H16F2N2O3S |
| Molecular Weight | 366.39 g/mol |
| Exact Mass | 366.08 |
| IUPAC Name | 3,5-difluoro-N-[2-hydroxy-2-(1-methylindol-3-yl)ethyl]benzenesulfonamide |
| SMILES | Cn1cc(C(O)CNS(=O)(=O)c2cc(F)cc(F)c2)c2ccccc21 |
| InChI | InChI=1S/C17H16F2N2O3S/c1-21-10-15(14-4-2-3-5-16(14)21)17(22)9-20-25(23,24)13-7-11(18)6-12(19)8-13/h2-8,10,17,20,22H,9H2,1H3 |
| InChIKey | DZCSEMRVMDMXGK-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 71.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.39 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |