C21H19N2OP — CID 134998534
(1R)-N-diphenylphosphoryl-1-isocyano-1-phenylethanamine (PubChem CID 134998534) has the molecular formula C21H19N2OP and a molecular weight of 346.37 g/mol. Its IUPAC name is (1R)-N-diphenylphosphoryl-1-isocyano-1-phenylethanamine.
| Compound Name | (1R)-N-diphenylphosphoryl-1-isocyano-1-phenylethanamine |
|---|---|
| PubChem CID | 134998534 |
| Molecular Formula | C21H19N2OP |
| Molecular Weight | 346.37 g/mol |
| Exact Mass | 346.12 |
| IUPAC Name | (1R)-N-diphenylphosphoryl-1-isocyano-1-phenylethanamine |
| SMILES | [C-]#[N+][C@](C)(NP(=O)(c1ccccc1)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H19N2OP/c1-21(22-2,18-12-6-3-7-13-18)23-25(24,19-14-8-4-9-15-19)20-16-10-5-11-17-20/h3-17H,1H3,(H,23,24)/t21-/m1/s1 |
| InChIKey | CZCMYSJPNXSNFZ-OAQYLSRUSA-N |
| XLogP | 4.30 |
| TPSA | 33.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.37 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|