C22H21N2OP — CID 135071298
2-(diphenylphosphorylamino)-2-(4-methylphenyl)propanenitrile (PubChem CID 135071298) has the molecular formula C22H21N2OP and a molecular weight of 360.40 g/mol. Its IUPAC name is 2-(diphenylphosphorylamino)-2-(4-methylphenyl)propanenitrile.
| Compound Name | 2-(diphenylphosphorylamino)-2-(4-methylphenyl)propanenitrile |
|---|---|
| PubChem CID | 135071298 |
| Molecular Formula | C22H21N2OP |
| Molecular Weight | 360.40 g/mol |
| Exact Mass | 360.14 |
| IUPAC Name | 2-(diphenylphosphorylamino)-2-(4-methylphenyl)propanenitrile |
| SMILES | Cc1ccc(C(C)(C#N)NP(=O)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C22H21N2OP/c1-18-13-15-19(16-14-18)22(2,17-23)24-26(25,20-9-5-3-6-10-20)21-11-7-4-8-12-21/h3-16H,1-2H3,(H,24,25) |
| InChIKey | RPAZFTVTONSQMZ-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.40 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|