About benzenethiol;1-tert-butyl-4-methylbenzene
benzenethiol;1-tert-butyl-4-methylbenzene (PubChem CID 158168635) has the molecular formula C17H22S
and a molecular weight of 258.43 g/mol. Its IUPAC name is benzenethiol;1-tert-butyl-4-methylbenzene.
Molecular Properties
| Compound Name | benzenethiol;1-tert-butyl-4-methylbenzene |
| PubChem CID | 158168635 |
| Molecular Formula | C17H22S |
| Molecular Weight | 258.43 g/mol |
| Exact Mass | 258.14 |
| IUPAC Name | benzenethiol;1-tert-butyl-4-methylbenzene |
| SMILES | Cc1ccc(C(C)(C)C)cc1.Sc1ccccc1 |
| InChI | InChI=1S/C11H16.C6H6S/c1-9-5-7-10(8-6-9)11(2,3)4;7-6-4-2-1-3-5-6/h5-8H,1-4H3;1-5,7H |
| InChIKey | FXDWSJDFJRNZKQ-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 258.43 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze benzenethiol;1-tert-butyl-4-methylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzenethiol;1-tert-butyl-4-methylbenzene?
The IUPAC name of benzenethiol;1-tert-butyl-4-methylbenzene (CID 158168635) is benzenethiol;1-tert-butyl-4-methylbenzene.
What is the SMILES notation for benzenethiol;1-tert-butyl-4-methylbenzene?
The canonical SMILES for benzenethiol;1-tert-butyl-4-methylbenzene is Cc1ccc(C(C)(C)C)cc1.Sc1ccccc1.
What is the InChIKey of benzenethiol;1-tert-butyl-4-methylbenzene?
The InChIKey is FXDWSJDFJRNZKQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16.C6H6S/c1-9-5-7-10(8-6-9)11(2,3)4;7-6-4-2-1-3-5-6/h5-8H,1-4H3;1-5,7H.
What are the key properties of benzenethiol;1-tert-butyl-4-methylbenzene?
benzenethiol;1-tert-butyl-4-methylbenzene has a molecular weight of 258.43 g/mol, XLogP of 5.27, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for benzenethiol;1-tert-butyl-4-methylbenzene is sourced from PubChem (CID 158168635), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).