C32H52S2 — CID 160733598
benzenethiol;2,3,4,5,6-pentatert-butylbenzenethiol (PubChem CID 160733598) has the molecular formula C32H52S2 and a molecular weight of 500.90 g/mol. Its IUPAC name is benzenethiol;2,3,4,5,6-pentatert-butylbenzenethiol.
| Compound Name | benzenethiol;2,3,4,5,6-pentatert-butylbenzenethiol |
|---|---|
| PubChem CID | 160733598 |
| Molecular Formula | C32H52S2 |
| Molecular Weight | 500.90 g/mol |
| Exact Mass | 500.35 |
| IUPAC Name | benzenethiol;2,3,4,5,6-pentatert-butylbenzenethiol |
| SMILES | CC(C)(C)c1c(S)c(C(C)(C)C)c(C(C)(C)C)c(C(C)(C)C)c1C(C)(C)C.Sc1ccccc1 |
| InChI | InChI=1S/C26H46S.C6H6S/c1-22(2,3)16-17(23(4,5)6)19(25(10,11)12)21(27)20(26(13,14)15)18(16)24(7,8)9;7-6-4-2-1-3-5-6/h27H,1-15H3;1-5,7H |
| InChIKey | RUQVVWKTNQTEDQ-UHFFFAOYSA-N |
| XLogP | 10.44 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.90 |
| LogP ≤ 5 | 10.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|