C24H34S2 — CID 14400702
2-[[2,5-di(propan-2-yl)phenyl]disulfanyl]-1,4-di(propan-2-yl)benzene (PubChem CID 14400702) has the molecular formula C24H34S2 and a molecular weight of 386.67 g/mol. Its IUPAC name is 2-[[2,5-di(propan-2-yl)phenyl]disulfanyl]-1,4-di(propan-2-yl)benzene.
| Compound Name | 2-[[2,5-di(propan-2-yl)phenyl]disulfanyl]-1,4-di(propan-2-yl)benzene |
|---|---|
| PubChem CID | 14400702 |
| Molecular Formula | C24H34S2 |
| Molecular Weight | 386.67 g/mol |
| Exact Mass | 386.21 |
| IUPAC Name | 2-[[2,5-di(propan-2-yl)phenyl]disulfanyl]-1,4-di(propan-2-yl)benzene |
| SMILES | CC(C)c1ccc(C(C)C)c(SSc2cc(C(C)C)ccc2C(C)C)c1 |
| InChI | InChI=1S/C24H34S2/c1-15(2)19-9-11-21(17(5)6)23(13-19)25-26-24-14-20(16(3)4)10-12-22(24)18(7)8/h9-18H,1-8H3 |
| InChIKey | ZNWAGDOHZWNZQM-UHFFFAOYSA-N |
| XLogP | 8.98 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.67 |
| LogP ≤ 5 | 8.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|