C36H58S2 — CID 12866217
1,3,5-tritert-butyl-2-[(2,4,6-tritert-butylphenyl)disulfanyl]benzene (PubChem CID 12866217) has the molecular formula C36H58S2 and a molecular weight of 554.99 g/mol. Its IUPAC name is 1,3,5-tritert-butyl-2-[(2,4,6-tritert-butylphenyl)disulfanyl]benzene.
| Compound Name | 1,3,5-tritert-butyl-2-[(2,4,6-tritert-butylphenyl)disulfanyl]benzene |
|---|---|
| PubChem CID | 12866217 |
| Molecular Formula | C36H58S2 |
| Molecular Weight | 554.99 g/mol |
| Exact Mass | 554.40 |
| IUPAC Name | 1,3,5-tritert-butyl-2-[(2,4,6-tritert-butylphenyl)disulfanyl]benzene |
| SMILES | CC(C)(C)c1cc(C(C)(C)C)c(SSc2c(C(C)(C)C)cc(C(C)(C)C)cc2C(C)(C)C)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C36H58S2/c1-31(2,3)23-19-25(33(7,8)9)29(26(20-23)34(10,11)12)37-38-30-27(35(13,14)15)21-24(32(4,5)6)22-28(30)36(16,17)18/h19-22H,1-18H3 |
| InChIKey | OGNGJDJRAMLSRS-UHFFFAOYSA-N |
| XLogP | 12.27 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.99 |
| LogP ≤ 5 | 12.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|