About 1-tert-butyl-4-methylbenzene;dibromozinc
1-tert-butyl-4-methylbenzene;dibromozinc (PubChem CID 174651577) has the molecular formula C11H16Br2Zn
and a molecular weight of 373.45 g/mol. Its IUPAC name is 1-tert-butyl-4-methylbenzene;dibromozinc.
Molecular Properties
| Compound Name | 1-tert-butyl-4-methylbenzene;dibromozinc |
| PubChem CID | 174651577 |
| Molecular Formula | C11H16Br2Zn |
| Molecular Weight | 373.45 g/mol |
| Exact Mass | 369.89 |
| IUPAC Name | 1-tert-butyl-4-methylbenzene;dibromozinc |
| SMILES | Br[Zn]Br.Cc1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C11H16.2BrH.Zn/c1-9-5-7-10(8-6-9)11(2,3)4;;;/h5-8H,1-4H3;2*1H;/q;;;+2/p-2 |
| InChIKey | IRRIAVVGODESQT-UHFFFAOYSA-L |
| XLogP | 4.98 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 373.45 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 1-tert-butyl-4-methylbenzene;dibromozinc with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-tert-butyl-4-methylbenzene;dibromozinc?
The IUPAC name of 1-tert-butyl-4-methylbenzene;dibromozinc (CID 174651577) is 1-tert-butyl-4-methylbenzene;dibromozinc.
What is the SMILES notation for 1-tert-butyl-4-methylbenzene;dibromozinc?
The canonical SMILES for 1-tert-butyl-4-methylbenzene;dibromozinc is Br[Zn]Br.Cc1ccc(C(C)(C)C)cc1.
What is the InChIKey of 1-tert-butyl-4-methylbenzene;dibromozinc?
The InChIKey is IRRIAVVGODESQT-UHFFFAOYSA-L. The full InChI is InChI=1S/C11H16.2BrH.Zn/c1-9-5-7-10(8-6-9)11(2,3)4;;;/h5-8H,1-4H3;2*1H;/q;;;+2/p-2.
What are the key properties of 1-tert-butyl-4-methylbenzene;dibromozinc?
1-tert-butyl-4-methylbenzene;dibromozinc has a molecular weight of 373.45 g/mol, XLogP of 4.98, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-tert-butyl-4-methylbenzene;dibromozinc is sourced from PubChem (CID 174651577), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).