C27H30 — CID 123709825
1-[2,3-bis(4-methylphenyl)cyclopropyl]-4-tert-butylbenzene (PubChem CID 123709825) has the molecular formula C27H30 and a molecular weight of 354.54 g/mol. Its IUPAC name is 1-[2,3-bis(4-methylphenyl)cyclopropyl]-4-tert-butylbenzene.
| Compound Name | 1-[2,3-bis(4-methylphenyl)cyclopropyl]-4-tert-butylbenzene |
|---|---|
| PubChem CID | 123709825 |
| Molecular Formula | C27H30 |
| Molecular Weight | 354.54 g/mol |
| Exact Mass | 354.23 |
| IUPAC Name | 1-[2,3-bis(4-methylphenyl)cyclopropyl]-4-tert-butylbenzene |
| SMILES | Cc1ccc(C2C(c3ccc(C)cc3)C2c2ccc(C(C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C27H30/c1-18-6-10-20(11-7-18)24-25(21-12-8-19(2)9-13-21)26(24)22-14-16-23(17-15-22)27(3,4)5/h6-17,24-26H,1-5H3 |
| InChIKey | FNSFGYQCDXYKLX-UHFFFAOYSA-N |
| XLogP | 7.27 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.54 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |