C33H45N — CID 126747851
N,N-bis[2-(4-tert-butylphenyl)propan-2-yl]-4-methylaniline (PubChem CID 126747851) has the molecular formula C33H45N and a molecular weight of 455.73 g/mol. Its IUPAC name is N,N-bis[2-(4-tert-butylphenyl)propan-2-yl]-4-methylaniline.
| Compound Name | N,N-bis[2-(4-tert-butylphenyl)propan-2-yl]-4-methylaniline |
|---|---|
| PubChem CID | 126747851 |
| Molecular Formula | C33H45N |
| Molecular Weight | 455.73 g/mol |
| Exact Mass | 455.36 |
| IUPAC Name | N,N-bis[2-(4-tert-butylphenyl)propan-2-yl]-4-methylaniline |
| SMILES | Cc1ccc(N(C(C)(C)c2ccc(C(C)(C)C)cc2)C(C)(C)c2ccc(C(C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C33H45N/c1-24-12-22-29(23-13-24)34(32(8,9)27-18-14-25(15-19-27)30(2,3)4)33(10,11)28-20-16-26(17-21-28)31(5,6)7/h12-23H,1-11H3 |
| InChIKey | WYJBELFYMARFPP-UHFFFAOYSA-N |
| XLogP | 9.27 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.73 |
| LogP ≤ 5 | 9.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |