C57H63N3 — CID 22900171
1-N,3-N,5-N-tris(4-tert-butylphenyl)-1-N,3-N,5-N-tris(4-methylphenyl)benzene-1,3,5-triamine (PubChem CID 22900171) has the molecular formula C57H63N3 and a molecular weight of 790.15 g/mol. Its IUPAC name is 1-N,3-N,5-N-tris(4-tert-butylphenyl)-1-N,3-N,5-N-tris(4-methylphenyl)benzene-1,3,5-triamine.
| Compound Name | 1-N,3-N,5-N-tris(4-tert-butylphenyl)-1-N,3-N,5-N-tris(4-methylphenyl)benzene-1,3,5-triamine |
|---|---|
| PubChem CID | 22900171 |
| Molecular Formula | C57H63N3 |
| Molecular Weight | 790.15 g/mol |
| Exact Mass | 789.50 |
| IUPAC Name | 1-N,3-N,5-N-tris(4-tert-butylphenyl)-1-N,3-N,5-N-tris(4-methylphenyl)benzene-1,3,5-triamine |
| SMILES | Cc1ccc(N(c2ccc(C(C)(C)C)cc2)c2cc(N(c3ccc(C)cc3)c3ccc(C(C)(C)C)cc3)cc(N(c3ccc(C)cc3)c3ccc(C(C)(C)C)cc3)c2)cc1 |
| InChI | InChI=1S/C57H63N3/c1-40-13-25-46(26-14-40)58(49-31-19-43(20-32-49)55(4,5)6)52-37-53(59(47-27-15-41(2)16-28-47)50-33-21-44(22-34-50)56(7,8)9)39-54(38-52)60(48-29-17-42(3)18-30-48)51-35-23-45(24-36-51)57(10,11)12/h13-39H,1-12H3 |
| InChIKey | DYTSYFSKYZTKAN-UHFFFAOYSA-N |
| XLogP | 16.91 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 790.15 |
| LogP ≤ 5 | 16.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |