C27H31Br2N — CID 58501498
3,5-dibromo-N,N-bis(4-tert-butylphenyl)-4-methylaniline (PubChem CID 58501498) has the molecular formula C27H31Br2N and a molecular weight of 529.36 g/mol. Its IUPAC name is 3,5-dibromo-N,N-bis(4-tert-butylphenyl)-4-methylaniline.
| Compound Name | 3,5-dibromo-N,N-bis(4-tert-butylphenyl)-4-methylaniline |
|---|---|
| PubChem CID | 58501498 |
| Molecular Formula | C27H31Br2N |
| Molecular Weight | 529.36 g/mol |
| Exact Mass | 527.08 |
| IUPAC Name | 3,5-dibromo-N,N-bis(4-tert-butylphenyl)-4-methylaniline |
| SMILES | Cc1c(Br)cc(N(c2ccc(C(C)(C)C)cc2)c2ccc(C(C)(C)C)cc2)cc1Br |
| InChI | InChI=1S/C27H31Br2N/c1-18-24(28)16-23(17-25(18)29)30(21-12-8-19(9-13-21)26(2,3)4)22-14-10-20(11-15-22)27(5,6)7/h8-17H,1-7H3 |
| InChIKey | YESXWMGLIAIBST-UHFFFAOYSA-N |
| XLogP | 9.58 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.36 |
| LogP ≤ 5 | 9.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |