C45H42N2 — CID 126627134
10-N-(4-tert-butylphenyl)-9-N,9-N,10-N-tris(4-methylphenyl)anthracene-9,10-diamine (PubChem CID 126627134) has the molecular formula C45H42N2 and a molecular weight of 610.85 g/mol. Its IUPAC name is 10-N-(4-tert-butylphenyl)-9-N,9-N,10-N-tris(4-methylphenyl)anthracene-9,10-diamine.
| Compound Name | 10-N-(4-tert-butylphenyl)-9-N,9-N,10-N-tris(4-methylphenyl)anthracene-9,10-diamine |
|---|---|
| PubChem CID | 126627134 |
| Molecular Formula | C45H42N2 |
| Molecular Weight | 610.85 g/mol |
| Exact Mass | 610.33 |
| IUPAC Name | 10-N-(4-tert-butylphenyl)-9-N,9-N,10-N-tris(4-methylphenyl)anthracene-9,10-diamine |
| SMILES | Cc1ccc(N(c2ccc(C)cc2)c2c3ccccc3c(N(c3ccc(C)cc3)c3ccc(C(C)(C)C)cc3)c3ccccc23)cc1 |
| InChI | InChI=1S/C45H42N2/c1-31-15-23-35(24-16-31)46(36-25-17-32(2)18-26-36)43-39-11-7-9-13-41(39)44(42-14-10-8-12-40(42)43)47(37-27-19-33(3)20-28-37)38-29-21-34(22-30-38)45(4,5)6/h7-30H,1-6H3 |
| InChIKey | TXYUIEOHLLIGTF-UHFFFAOYSA-N |
| XLogP | 13.16 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.85 |
| LogP ≤ 5 | 13.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'diaminobenzene_3', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|