C46H44N2 — CID 59133310
9-N,10-N-bis(4-methylphenyl)-9-N,10-N-bis(4-propan-2-ylphenyl)anthracene-9,10-diamine (PubChem CID 59133310) has the molecular formula C46H44N2 and a molecular weight of 624.87 g/mol. Its IUPAC name is 9-N,10-N-bis(4-methylphenyl)-9-N,10-N-bis(4-propan-2-ylphenyl)anthracene-9,10-diamine.
| Compound Name | 9-N,10-N-bis(4-methylphenyl)-9-N,10-N-bis(4-propan-2-ylphenyl)anthracene-9,10-diamine |
|---|---|
| PubChem CID | 59133310 |
| Molecular Formula | C46H44N2 |
| Molecular Weight | 624.87 g/mol |
| Exact Mass | 624.35 |
| IUPAC Name | 9-N,10-N-bis(4-methylphenyl)-9-N,10-N-bis(4-propan-2-ylphenyl)anthracene-9,10-diamine |
| SMILES | Cc1ccc(N(c2ccc(C(C)C)cc2)c2c3ccccc3c(N(c3ccc(C)cc3)c3ccc(C(C)C)cc3)c3ccccc23)cc1 |
| InChI | InChI=1S/C46H44N2/c1-31(2)35-19-27-39(28-20-35)47(37-23-15-33(5)16-24-37)45-41-11-7-9-13-43(41)46(44-14-10-8-12-42(44)45)48(38-25-17-34(6)18-26-38)40-29-21-36(22-30-40)32(3)4/h7-32H,1-6H3 |
| InChIKey | XDGZJXIRKASDIR-UHFFFAOYSA-N |
| XLogP | 13.80 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.87 |
| LogP ≤ 5 | 13.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'diaminobenzene_3', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|