C56H64N2 — CID 89058632
2-(7-methylnonyl)-9-N,10-N-bis(4-methylphenyl)-9-N,10-N-bis(4-propan-2-ylphenyl)anthracene-9,10-diamine (PubChem CID 89058632) has the molecular formula C56H64N2 and a molecular weight of 765.14 g/mol. Its IUPAC name is 2-(7-methylnonyl)-9-N,10-N-bis(4-methylphenyl)-9-N,10-N-bis(4-propan-2-ylphenyl)anthracene-9,10-diamine.
| Compound Name | 2-(7-methylnonyl)-9-N,10-N-bis(4-methylphenyl)-9-N,10-N-bis(4-propan-2-ylphenyl)anthracene-9,10-diamine |
|---|---|
| PubChem CID | 89058632 |
| Molecular Formula | C56H64N2 |
| Molecular Weight | 765.14 g/mol |
| Exact Mass | 764.51 |
| IUPAC Name | 2-(7-methylnonyl)-9-N,10-N-bis(4-methylphenyl)-9-N,10-N-bis(4-propan-2-ylphenyl)anthracene-9,10-diamine |
| SMILES | CCC(C)CCCCCCc1ccc2c(N(c3ccc(C)cc3)c3ccc(C(C)C)cc3)c3ccccc3c(N(c3ccc(C)cc3)c3ccc(C(C)C)cc3)c2c1 |
| InChI | InChI=1S/C56H64N2/c1-9-41(6)16-12-10-11-13-17-44-24-37-53-54(38-44)56(58(48-31-22-43(8)23-32-48)50-35-27-46(28-36-50)40(4)5)52-19-15-14-18-51(52)55(53)57(47-29-20-42(7)21-30-47)49-33-25-45(26-34-49)39(2)3/h14-15,18-41H,9-13,16-17H2,1-8H3 |
| InChIKey | AOEAHJRAFOOPPU-UHFFFAOYSA-N |
| XLogP | 17.34 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 765.14 |
| LogP ≤ 5 | 17.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diaminobenzene_3', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|