C52H56N2 — CID 58371061
9-N,10-N-bis(4-tert-butyl-2,6-dimethylphenyl)-9-N,10-N-bis(4-methylphenyl)anthracene-9,10-diamine (PubChem CID 58371061) has the molecular formula C52H56N2 and a molecular weight of 709.03 g/mol. Its IUPAC name is 9-N,10-N-bis(4-tert-butyl-2,6-dimethylphenyl)-9-N,10-N-bis(4-methylphenyl)anthracene-9,10-diamine.
| Compound Name | 9-N,10-N-bis(4-tert-butyl-2,6-dimethylphenyl)-9-N,10-N-bis(4-methylphenyl)anthracene-9,10-diamine |
|---|---|
| PubChem CID | 58371061 |
| Molecular Formula | C52H56N2 |
| Molecular Weight | 709.03 g/mol |
| Exact Mass | 708.44 |
| IUPAC Name | 9-N,10-N-bis(4-tert-butyl-2,6-dimethylphenyl)-9-N,10-N-bis(4-methylphenyl)anthracene-9,10-diamine |
| SMILES | Cc1ccc(N(c2c(C)cc(C(C)(C)C)cc2C)c2c3ccccc3c(N(c3ccc(C)cc3)c3c(C)cc(C(C)(C)C)cc3C)c3ccccc23)cc1 |
| InChI | InChI=1S/C52H56N2/c1-33-21-25-41(26-22-33)53(47-35(3)29-39(30-36(47)4)51(7,8)9)49-43-17-13-15-19-45(43)50(46-20-16-14-18-44(46)49)54(42-27-23-34(2)24-28-42)48-37(5)31-40(32-38(48)6)52(10,11)12/h13-32H,1-12H3 |
| InChIKey | QQBWAYGJQDSTEC-UHFFFAOYSA-N |
| XLogP | 15.38 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 709.03 |
| LogP ≤ 5 | 15.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'diaminobenzene_3', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|