About copper;bis([(diphenylphosphorylamino)-phenylphosphoryl]benzene)
copper;bis([(diphenylphosphorylamino)-phenylphosphoryl]benzene) (PubChem CID 175947269) has the molecular formula C48H42CuN2O4P4
and a molecular weight of 898.32 g/mol. Its IUPAC name is copper;bis([(diphenylphosphorylamino)-phenylphosphoryl]benzene).
Molecular Properties
| Compound Name | copper;bis([(diphenylphosphorylamino)-phenylphosphoryl]benzene) |
| PubChem CID | 175947269 |
| Molecular Formula | C48H42CuN2O4P4 |
| Molecular Weight | 898.32 g/mol |
| Exact Mass | 897.14 |
| IUPAC Name | copper;bis([(diphenylphosphorylamino)-phenylphosphoryl]benzene) |
| SMILES | O=P(NP(=O)(c1ccccc1)c1ccccc1)(c1ccccc1)c1ccccc1.O=P(NP(=O)(c1ccccc1)c1ccccc1)(c1ccccc1)c1ccccc1.[Cu] |
| InChI | InChI=1S/2C24H21NO2P2.Cu/c2*26-28(21-13-5-1-6-14-21,22-15-7-2-8-16-22)25-29(27,23-17-9-3-10-18-23)24-19-11-4-12-20-24;/h2*1-20H,(H,25,26,27); |
| InChIKey | HJAKVGDNFZQIGE-UHFFFAOYSA-N |
| XLogP | 8.87 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 59 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 898.32 |
| LogP ≤ 5 | 8.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze copper;bis([(diphenylphosphorylamino)-phenylphosphoryl]benzene) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of copper;bis([(diphenylphosphorylamino)-phenylphosphoryl]benzene)?
The IUPAC name of copper;bis([(diphenylphosphorylamino)-phenylphosphoryl]benzene) (CID 175947269) is copper;bis([(diphenylphosphorylamino)-phenylphosphoryl]benzene).
What is the SMILES notation for copper;bis([(diphenylphosphorylamino)-phenylphosphoryl]benzene)?
The canonical SMILES for copper;bis([(diphenylphosphorylamino)-phenylphosphoryl]benzene) is O=P(NP(=O)(c1ccccc1)c1ccccc1)(c1ccccc1)c1ccccc1.O=P(NP(=O)(c1ccccc1)c1ccccc1)(c1ccccc1)c1ccccc1.[Cu].
What is the InChIKey of copper;bis([(diphenylphosphorylamino)-phenylphosphoryl]benzene)?
The InChIKey is HJAKVGDNFZQIGE-UHFFFAOYSA-N. The full InChI is InChI=1S/2C24H21NO2P2.Cu/c2*26-28(21-13-5-1-6-14-21,22-15-7-2-8-16-22)25-29(27,23-17-9-3-10-18-23)24-19-11-4-12-20-24;/h2*1-20H,(H,25,26,27);.
What are the key properties of copper;bis([(diphenylphosphorylamino)-phenylphosphoryl]benzene)?
copper;bis([(diphenylphosphorylamino)-phenylphosphoryl]benzene) has a molecular weight of 898.32 g/mol, XLogP of 8.87, 12 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for copper;bis([(diphenylphosphorylamino)-phenylphosphoryl]benzene) is sourced from PubChem (CID 175947269), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).