C25H24N2O2P2 — CID 71676353
4-N-diphenylphosphoryl-1-N-[methyl(phenyl)phosphoryl]benzene-1,4-diamine (PubChem CID 71676353) has the molecular formula C25H24N2O2P2 and a molecular weight of 446.43 g/mol. Its IUPAC name is 4-N-diphenylphosphoryl-1-N-[methyl(phenyl)phosphoryl]benzene-1,4-diamine.
| Compound Name | 4-N-diphenylphosphoryl-1-N-[methyl(phenyl)phosphoryl]benzene-1,4-diamine |
|---|---|
| PubChem CID | 71676353 |
| Molecular Formula | C25H24N2O2P2 |
| Molecular Weight | 446.43 g/mol |
| Exact Mass | 446.13 |
| IUPAC Name | 4-N-diphenylphosphoryl-1-N-[methyl(phenyl)phosphoryl]benzene-1,4-diamine |
| SMILES | CP(=O)(Nc1ccc(NP(=O)(c2ccccc2)c2ccccc2)cc1)c1ccccc1 |
| InChI | InChI=1S/C25H24N2O2P2/c1-30(28,23-11-5-2-6-12-23)26-21-17-19-22(20-18-21)27-31(29,24-13-7-3-8-14-24)25-15-9-4-10-16-25/h2-20H,1H3,(H,26,28)(H,27,29) |
| InChIKey | LTGDHKLJXXFJKV-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.43 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|