C24H28NOP — CID 102170611
N-diphenylphosphoryl-2,6-di(propan-2-yl)aniline (PubChem CID 102170611) has the molecular formula C24H28NOP and a molecular weight of 377.47 g/mol. Its IUPAC name is N-diphenylphosphoryl-2,6-di(propan-2-yl)aniline.
| Compound Name | N-diphenylphosphoryl-2,6-di(propan-2-yl)aniline |
|---|---|
| PubChem CID | 102170611 |
| Molecular Formula | C24H28NOP |
| Molecular Weight | 377.47 g/mol |
| Exact Mass | 377.19 |
| IUPAC Name | N-diphenylphosphoryl-2,6-di(propan-2-yl)aniline |
| SMILES | CC(C)c1cccc(C(C)C)c1NP(=O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C24H28NOP/c1-18(2)22-16-11-17-23(19(3)4)24(22)25-27(26,20-12-7-5-8-13-20)21-14-9-6-10-15-21/h5-19H,1-4H3,(H,25,26) |
| InChIKey | GRCCZYJRVXTABI-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.47 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|