C36H44NP — CID 58140371
N-[diphenyl-(4,4,6,6-tetramethyl-5H-pentalen-2-ylidene)-λ5-phosphanyl]-2,6-di(propan-2-yl)aniline (PubChem CID 58140371) has the molecular formula C36H44NP and a molecular weight of 521.73 g/mol. Its IUPAC name is N-[diphenyl-(4,4,6,6-tetramethyl-5H-pentalen-2-ylidene)-λ5-phosphanyl]-2,6-di(propan-2-yl)aniline.
| Compound Name | N-[diphenyl-(4,4,6,6-tetramethyl-5H-pentalen-2-ylidene)-λ5-phosphanyl]-2,6-di(propan-2-yl)aniline |
|---|---|
| PubChem CID | 58140371 |
| Molecular Formula | C36H44NP |
| Molecular Weight | 521.73 g/mol |
| Exact Mass | 521.32 |
| IUPAC Name | N-[diphenyl-(4,4,6,6-tetramethyl-5H-pentalen-2-ylidene)-λ5-phosphanyl]-2,6-di(propan-2-yl)aniline |
| SMILES | CC(C)c1cccc(C(C)C)c1NP(=C1C=C2C(=C1)C(C)(C)CC2(C)C)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C36H44NP/c1-25(2)30-20-15-21-31(26(3)4)34(30)37-38(27-16-11-9-12-17-27,28-18-13-10-14-19-28)29-22-32-33(23-29)36(7,8)24-35(32,5)6/h9-23,25-26,37H,24H2,1-8H3 |
| InChIKey | LASKRANOKXVOHF-UHFFFAOYSA-N |
| XLogP | 9.42 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.73 |
| LogP ≤ 5 | 9.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|