C30H37N — CID 162435803
1-[2,6-di(propan-2-yl)phenyl]-2,4-dimethyl-2,4-diphenylpyrrolidine (PubChem CID 162435803) has the molecular formula C30H37N and a molecular weight of 411.63 g/mol. Its IUPAC name is 1-[2,6-di(propan-2-yl)phenyl]-2,4-dimethyl-2,4-diphenylpyrrolidine.
| Compound Name | 1-[2,6-di(propan-2-yl)phenyl]-2,4-dimethyl-2,4-diphenylpyrrolidine |
|---|---|
| PubChem CID | 162435803 |
| Molecular Formula | C30H37N |
| Molecular Weight | 411.63 g/mol |
| Exact Mass | 411.29 |
| IUPAC Name | 1-[2,6-di(propan-2-yl)phenyl]-2,4-dimethyl-2,4-diphenylpyrrolidine |
| SMILES | CC(C)c1cccc(C(C)C)c1N1CC(C)(c2ccccc2)CC1(C)c1ccccc1 |
| InChI | InChI=1S/C30H37N/c1-22(2)26-18-13-19-27(23(3)4)28(26)31-21-29(5,24-14-9-7-10-15-24)20-30(31,6)25-16-11-8-12-17-25/h7-19,22-23H,20-21H2,1-6H3 |
| InChIKey | GFNCMUWTMOZAQL-UHFFFAOYSA-N |
| XLogP | 8.02 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.63 |
| LogP ≤ 5 | 8.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |